C20H37NO5 — CID 54279485
4-[2-[(1R,2R,3R,4S)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]-N-hydroxy-N-methylbutanamide (PubChem CID 54279485) has the molecular formula C20H37NO5 and a molecular weight of 371.52 g/mol. Its IUPAC name is 4-[2-[(1R,2R,3R,4S)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]-N-hydroxy-N-methylbutanamide.
| Compound Name | 4-[2-[(1R,2R,3R,4S)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]-N-hydroxy-N-methylbutanamide |
|---|---|
| PubChem CID | 54279485 |
| Molecular Formula | C20H37NO5 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | 4-[2-[(1R,2R,3R,4S)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]-N-hydroxy-N-methylbutanamide |
| SMILES | CCCCCCOC[C@H]1[C@@H](CCOCCCC(=O)N(C)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C20H37NO5/c1-3-4-5-6-12-25-15-17-16(18-9-10-19(17)26-18)11-14-24-13-7-8-20(22)21(2)23/h16-19,23H,3-15H2,1-2H3/t16-,17+,18-,19+/m1/s1 |
| InChIKey | RPUBURQHQFZGIL-HCXYKTFWSA-N |
| XLogP | 3.41 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|