C21H31NO4S — CID 54469164
N-hydroxy-N-methyl-5-[[(1R,2S,3S,4S)-3-(2-phenylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanamide (PubChem CID 54469164) has the molecular formula C21H31NO4S and a molecular weight of 393.55 g/mol. Its IUPAC name is N-hydroxy-N-methyl-5-[[(1R,2S,3S,4S)-3-(2-phenylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanamide.
| Compound Name | N-hydroxy-N-methyl-5-[[(1R,2S,3S,4S)-3-(2-phenylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanamide |
|---|---|
| PubChem CID | 54469164 |
| Molecular Formula | C21H31NO4S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | N-hydroxy-N-methyl-5-[[(1R,2S,3S,4S)-3-(2-phenylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanamide |
| SMILES | CN(O)C(=O)CCCCOC[C@@H]1[C@H](CCSc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C21H31NO4S/c1-22(24)21(23)9-5-6-13-25-15-18-17(19-10-11-20(18)26-19)12-14-27-16-7-3-2-4-8-16/h2-4,7-8,17-20,24H,5-6,9-15H2,1H3/t17-,18+,19-,20+/m0/s1 |
| InChIKey | XHBRUGIZHDWUGN-ZGXWSNOMSA-N |
| XLogP | 4.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|