C21H31NO4S — CID 57004128
N-hydroxy-5-[[3-(2-phenylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]hexanamide (PubChem CID 57004128) has the molecular formula C21H31NO4S and a molecular weight of 393.55 g/mol. Its IUPAC name is N-hydroxy-5-[[3-(2-phenylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]hexanamide.
| Compound Name | N-hydroxy-5-[[3-(2-phenylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]hexanamide |
|---|---|
| PubChem CID | 57004128 |
| Molecular Formula | C21H31NO4S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | N-hydroxy-5-[[3-(2-phenylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]hexanamide |
| SMILES | CC(CCCC(=O)NO)OCC1C2CCC(O2)C1CCSc1ccccc1 |
| InChI | InChI=1S/C21H31NO4S/c1-15(6-5-9-21(23)22-24)25-14-18-17(19-10-11-20(18)26-19)12-13-27-16-7-3-2-4-8-16/h2-4,7-8,15,17-20,24H,5-6,9-14H2,1H3,(H,22,23) |
| InChIKey | FUJSHEDUIMBYQN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|