C20H34O — CID 88720075
(1E,3E,5E)-7-[(1R,2S)-2-octylcyclopentyl]hepta-1,3,5-trien-1-ol (PubChem CID 88720075) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (1E,3E,5E)-7-[(1R,2S)-2-octylcyclopentyl]hepta-1,3,5-trien-1-ol.
| Compound Name | (1E,3E,5E)-7-[(1R,2S)-2-octylcyclopentyl]hepta-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 88720075 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (1E,3E,5E)-7-[(1R,2S)-2-octylcyclopentyl]hepta-1,3,5-trien-1-ol |
| SMILES | CCCCCCCC[C@H]1CCC[C@@H]1C/C=C/C=C/C=C/O |
| InChI | InChI=1S/C20H34O/c1-2-3-4-5-7-10-14-19-16-13-17-20(19)15-11-8-6-9-12-18-21/h6,8-9,11-12,18-21H,2-5,7,10,13-17H2,1H3/b9-6+,11-8+,18-12+/t19-,20-/m0/s1 |
| InChIKey | PSLLIOASIVGJTO-SZHBJVSKSA-N |
| XLogP | 6.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|