C24H44O4 — CID 88786031
2-[5-[(1S,2S)-2-[(E)-3-(1-butylcyclobutyl)prop-1-enyl]cyclopentyl]pentyl]propane-1,1,1,3-tetrol (PubChem CID 88786031) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is 2-[5-[(1S,2S)-2-[(E)-3-(1-butylcyclobutyl)prop-1-enyl]cyclopentyl]pentyl]propane-1,1,1,3-tetrol.
| Compound Name | 2-[5-[(1S,2S)-2-[(E)-3-(1-butylcyclobutyl)prop-1-enyl]cyclopentyl]pentyl]propane-1,1,1,3-tetrol |
|---|---|
| PubChem CID | 88786031 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | 2-[5-[(1S,2S)-2-[(E)-3-(1-butylcyclobutyl)prop-1-enyl]cyclopentyl]pentyl]propane-1,1,1,3-tetrol |
| SMILES | CCCCC1(C/C=C/[C@H]2CCC[C@@H]2CCCCCC(CO)C(O)(O)O)CCC1 |
| InChI | InChI=1S/C24H44O4/c1-2-3-15-23(17-9-18-23)16-8-13-21-12-7-11-20(21)10-5-4-6-14-22(19-25)24(26,27)28/h8,13,20-22,25-28H,2-7,9-12,14-19H2,1H3/b13-8+/t20-,21+,22?/m0/s1 |
| InChIKey | FGGBPBPNWWIDIZ-UNOFAXBVSA-N |
| XLogP | 4.90 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|