C22H42O4 — CID 88786211
2-[5-[(1S,2S)-2-[(E)-3-methyloct-1-enyl]cyclopentyl]pentyl]propane-1,1,1,3-tetrol (PubChem CID 88786211) has the molecular formula C22H42O4 and a molecular weight of 370.57 g/mol. Its IUPAC name is 2-[5-[(1S,2S)-2-[(E)-3-methyloct-1-enyl]cyclopentyl]pentyl]propane-1,1,1,3-tetrol.
| Compound Name | 2-[5-[(1S,2S)-2-[(E)-3-methyloct-1-enyl]cyclopentyl]pentyl]propane-1,1,1,3-tetrol |
|---|---|
| PubChem CID | 88786211 |
| Molecular Formula | C22H42O4 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | 2-[5-[(1S,2S)-2-[(E)-3-methyloct-1-enyl]cyclopentyl]pentyl]propane-1,1,1,3-tetrol |
| SMILES | CCCCCC(C)/C=C/[C@H]1CCC[C@@H]1CCCCCC(CO)C(O)(O)O |
| InChI | InChI=1S/C22H42O4/c1-3-4-6-10-18(2)15-16-20-13-9-12-19(20)11-7-5-8-14-21(17-23)22(24,25)26/h15-16,18-21,23-26H,3-14,17H2,1-2H3/b16-15+/t18?,19-,20+,21?/m0/s1 |
| InChIKey | GEKQNQUPPOHAHQ-WCNLFWCSSA-N |
| XLogP | 4.36 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|