C24H44O6S — CID 57311011
2-(dihydroxymethyl)-2-(2,3-dihydroxypropylsulfanyl)-7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptanoic acid (PubChem CID 57311011) has the molecular formula C24H44O6S and a molecular weight of 460.68 g/mol. Its IUPAC name is 2-(dihydroxymethyl)-2-(2,3-dihydroxypropylsulfanyl)-7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptanoic acid.
| Compound Name | 2-(dihydroxymethyl)-2-(2,3-dihydroxypropylsulfanyl)-7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 57311011 |
| Molecular Formula | C24H44O6S |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | 2-(dihydroxymethyl)-2-(2,3-dihydroxypropylsulfanyl)-7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptanoic acid |
| SMILES | CCCCCCC=C[C@H]1CCC[C@@H]1CCCCCC(SCC(O)CO)(C(=O)O)C(O)O |
| InChI | InChI=1S/C24H44O6S/c1-2-3-4-5-6-8-12-19-14-11-15-20(19)13-9-7-10-16-24(22(27)28,23(29)30)31-18-21(26)17-25/h8,12,19-22,25-28H,2-7,9-11,13-18H2,1H3,(H,29,30)/t19-,20-,21?,24?/m0/s1 |
| InChIKey | RCHULDRNUACIAO-SZYSUKIFSA-N |
| XLogP | 4.10 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|