C20H26BrCl2NO3 — CID 58182398
[4-[[(1S,5S)-3-bromo-2-chloro-5-[(Z)-hex-2-enyl]cyclopentyl]methoxy]-6-chloro-2-pyridinyl]methyl acetate (PubChem CID 58182398) has the molecular formula C20H26BrCl2NO3 and a molecular weight of 479.24 g/mol. Its IUPAC name is [4-[[(1S,5S)-3-bromo-2-chloro-5-[(Z)-hex-2-enyl]cyclopentyl]methoxy]-6-chloro-2-pyridinyl]methyl acetate.
| Compound Name | [4-[[(1S,5S)-3-bromo-2-chloro-5-[(Z)-hex-2-enyl]cyclopentyl]methoxy]-6-chloro-2-pyridinyl]methyl acetate |
|---|---|
| PubChem CID | 58182398 |
| Molecular Formula | C20H26BrCl2NO3 |
| Molecular Weight | 479.24 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | [4-[[(1S,5S)-3-bromo-2-chloro-5-[(Z)-hex-2-enyl]cyclopentyl]methoxy]-6-chloro-2-pyridinyl]methyl acetate |
| SMILES | CCC/C=C\C[C@H]1CC(Br)C(Cl)[C@@H]1COc1cc(Cl)nc(COC(C)=O)c1 |
| InChI | InChI=1S/C20H26BrCl2NO3/c1-3-4-5-6-7-14-8-18(21)20(23)17(14)12-27-16-9-15(11-26-13(2)25)24-19(22)10-16/h5-6,9-10,14,17-18,20H,3-4,7-8,11-12H2,1-2H3/b6-5-/t14-,17+,18?,20?/m0/s1 |
| InChIKey | MQKBQOGZKGQBME-YTSGAZDZSA-N |
| XLogP | 5.93 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.24 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|