C24H31BrCl2O5S — CID 123315310
2-hydroxyethyl 7-[(1S,2S)-2-[[3-(acetyloxymethyl)-5-chlorophenyl]sulfanylmethyl]-4-bromo-3-chlorocyclopentyl]hept-5-enoate (PubChem CID 123315310) has the molecular formula C24H31BrCl2O5S and a molecular weight of 582.38 g/mol. Its IUPAC name is 2-hydroxyethyl 7-[(1S,2S)-2-[[3-(acetyloxymethyl)-5-chlorophenyl]sulfanylmethyl]-4-bromo-3-chlorocyclopentyl]hept-5-enoate.
| Compound Name | 2-hydroxyethyl 7-[(1S,2S)-2-[[3-(acetyloxymethyl)-5-chlorophenyl]sulfanylmethyl]-4-bromo-3-chlorocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 123315310 |
| Molecular Formula | C24H31BrCl2O5S |
| Molecular Weight | 582.38 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | 2-hydroxyethyl 7-[(1S,2S)-2-[[3-(acetyloxymethyl)-5-chlorophenyl]sulfanylmethyl]-4-bromo-3-chlorocyclopentyl]hept-5-enoate |
| SMILES | CC(=O)OCc1cc(Cl)cc(SC[C@H]2C(Cl)C(Br)C[C@@H]2CC=CCCCC(=O)OCCO)c1 |
| InChI | InChI=1S/C24H31BrCl2O5S/c1-16(29)32-14-17-10-19(26)13-20(11-17)33-15-21-18(12-22(25)24(21)27)6-4-2-3-5-7-23(30)31-9-8-28/h2,4,10-11,13,18,21-22,24,28H,3,5-9,12,14-15H2,1H3/t18-,21+,22?,24?/m0/s1 |
| InChIKey | LXVYFKBKWNUPII-QNVDVAKXSA-N |
| XLogP | 6.15 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.38 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|