C31H50ClNO5 — CID 143891135
ethane;2-morpholin-4-ylethyl 6-[5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hex-5-enoate (PubChem CID 143891135) has the molecular formula C31H50ClNO5 and a molecular weight of 552.20 g/mol. Its IUPAC name is ethane;2-morpholin-4-ylethyl 6-[5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hex-5-enoate.
| Compound Name | ethane;2-morpholin-4-ylethyl 6-[5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hex-5-enoate |
|---|---|
| PubChem CID | 143891135 |
| Molecular Formula | C31H50ClNO5 |
| Molecular Weight | 552.20 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | ethane;2-morpholin-4-ylethyl 6-[5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hex-5-enoate |
| SMILES | CC.CCCCCC(O)c1ccc(C2C(O)CC(Cl)C2C=CCCCC(=O)OCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C29H44ClNO5.C2H6/c1-2-3-5-9-26(32)22-11-13-23(14-12-22)29-24(25(30)21-27(29)33)8-6-4-7-10-28(34)36-20-17-31-15-18-35-19-16-31;1-2/h6,8,11-14,24-27,29,32-33H,2-5,7,9-10,15-21H2,1H3;1-2H3 |
| InChIKey | MMVNBMNJDBFSGM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.20 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|