C25H36ClNO3 — CID 24811839
7-[3-chloro-1-[4-(1-hydroxy-5,5-dimethylhexyl)phenyl]pyrrolidin-2-yl]hept-6-ynoic acid (PubChem CID 24811839) has the molecular formula C25H36ClNO3 and a molecular weight of 434.02 g/mol. Its IUPAC name is 7-[3-chloro-1-[4-(1-hydroxy-5,5-dimethylhexyl)phenyl]pyrrolidin-2-yl]hept-6-ynoic acid.
| Compound Name | 7-[3-chloro-1-[4-(1-hydroxy-5,5-dimethylhexyl)phenyl]pyrrolidin-2-yl]hept-6-ynoic acid |
|---|---|
| PubChem CID | 24811839 |
| Molecular Formula | C25H36ClNO3 |
| Molecular Weight | 434.02 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 7-[3-chloro-1-[4-(1-hydroxy-5,5-dimethylhexyl)phenyl]pyrrolidin-2-yl]hept-6-ynoic acid |
| SMILES | CC(C)(C)CCCC(O)c1ccc(N2CCC(Cl)C2C#CCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C25H36ClNO3/c1-25(2,3)17-8-10-23(28)19-12-14-20(15-13-19)27-18-16-21(26)22(27)9-6-4-5-7-11-24(29)30/h12-15,21-23,28H,4-5,7-8,10-11,16-18H2,1-3H3,(H,29,30) |
| InChIKey | FTKLPCFHSRIIDD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.02 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|