C25H34NO4P — CID 118404504
[3-[[3-butyl-5-oxo-1-(3-propan-2-ylphenyl)pyrrolidin-2-yl]methoxymethyl]phenyl]phosphonous acid (PubChem CID 118404504) has the molecular formula C25H34NO4P and a molecular weight of 443.52 g/mol. Its IUPAC name is [3-[[3-butyl-5-oxo-1-(3-propan-2-ylphenyl)pyrrolidin-2-yl]methoxymethyl]phenyl]phosphonous acid.
| Compound Name | [3-[[3-butyl-5-oxo-1-(3-propan-2-ylphenyl)pyrrolidin-2-yl]methoxymethyl]phenyl]phosphonous acid |
|---|---|
| PubChem CID | 118404504 |
| Molecular Formula | C25H34NO4P |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | [3-[[3-butyl-5-oxo-1-(3-propan-2-ylphenyl)pyrrolidin-2-yl]methoxymethyl]phenyl]phosphonous acid |
| SMILES | CCCCC1CC(=O)N(c2cccc(C(C)C)c2)C1COCc1cccc(P(O)O)c1 |
| InChI | InChI=1S/C25H34NO4P/c1-4-5-9-21-15-25(27)26(22-11-7-10-20(14-22)18(2)3)24(21)17-30-16-19-8-6-12-23(13-19)31(28)29/h6-8,10-14,18,21,24,28-29H,4-5,9,15-17H2,1-3H3 |
| InChIKey | WDPUUVUJLIEUDL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|