C21H21NO5 — CID 76650529
methyl 3-[[1-(4-formylphenyl)-5-oxopyrrolidin-2-yl]methoxymethyl]benzoate (PubChem CID 76650529) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is methyl 3-[[1-(4-formylphenyl)-5-oxopyrrolidin-2-yl]methoxymethyl]benzoate.
| Compound Name | methyl 3-[[1-(4-formylphenyl)-5-oxopyrrolidin-2-yl]methoxymethyl]benzoate |
|---|---|
| PubChem CID | 76650529 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | methyl 3-[[1-(4-formylphenyl)-5-oxopyrrolidin-2-yl]methoxymethyl]benzoate |
| SMILES | COC(=O)c1cccc(COCC2CCC(=O)N2c2ccc(C=O)cc2)c1 |
| InChI | InChI=1S/C21H21NO5/c1-26-21(25)17-4-2-3-16(11-17)13-27-14-19-9-10-20(24)22(19)18-7-5-15(12-23)6-8-18/h2-8,11-12,19H,9-10,13-14H2,1H3 |
| InChIKey | JYXSLRFTMQUOQY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|