C15H23NO3 — CID 176845562
methyl 3-[2-(2-methylpropylamino)ethoxymethyl]benzoate (PubChem CID 176845562) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl 3-[2-(2-methylpropylamino)ethoxymethyl]benzoate.
| Compound Name | methyl 3-[2-(2-methylpropylamino)ethoxymethyl]benzoate |
|---|---|
| PubChem CID | 176845562 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | methyl 3-[2-(2-methylpropylamino)ethoxymethyl]benzoate |
| SMILES | COC(=O)c1cccc(COCCNCC(C)C)c1 |
| InChI | InChI=1S/C15H23NO3/c1-12(2)10-16-7-8-19-11-13-5-4-6-14(9-13)15(17)18-3/h4-6,9,12,16H,7-8,10-11H2,1-3H3 |
| InChIKey | XDGUIHSYNDIWFD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|