C23H30N2O3S2 — CID 70970618
2-[2-[(2R)-1-(4-heptylphenyl)-5-oxopyrrolidin-2-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 70970618) has the molecular formula C23H30N2O3S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-[2-[(2R)-1-(4-heptylphenyl)-5-oxopyrrolidin-2-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(2R)-1-(4-heptylphenyl)-5-oxopyrrolidin-2-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 70970618 |
| Molecular Formula | C23H30N2O3S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-[2-[(2R)-1-(4-heptylphenyl)-5-oxopyrrolidin-2-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCCCCc1ccc(N2C(=O)CC[C@@H]2CCSc2nc(C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C23H30N2O3S2/c1-2-3-4-5-6-7-17-8-10-18(11-9-17)25-19(12-13-21(25)26)14-15-29-23-24-20(16-30-23)22(27)28/h8-11,16,19H,2-7,12-15H2,1H3,(H,27,28)/t19-/m1/s1 |
| InChIKey | RKOKNZMMCRTYFG-LJQANCHMSA-N |
| XLogP | 6.03 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|