C23H28N2O3S — CID 70970631
2-[(Z)-3-[(2R)-1-(4-hexylphenyl)-5-oxopyrrolidin-2-yl]prop-1-enyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 70970631) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 2-[(Z)-3-[(2R)-1-(4-hexylphenyl)-5-oxopyrrolidin-2-yl]prop-1-enyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(Z)-3-[(2R)-1-(4-hexylphenyl)-5-oxopyrrolidin-2-yl]prop-1-enyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 70970631 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-[(Z)-3-[(2R)-1-(4-hexylphenyl)-5-oxopyrrolidin-2-yl]prop-1-enyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCCCc1ccc(N2C(=O)CC[C@@H]2C/C=C\c2nc(C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C23H28N2O3S/c1-2-3-4-5-7-17-10-12-19(13-11-17)25-18(14-15-22(25)26)8-6-9-21-24-20(16-29-21)23(27)28/h6,9-13,16,18H,2-5,7-8,14-15H2,1H3,(H,27,28)/b9-6-/t18-/m0/s1 |
| InChIKey | NMTVOFTYXIVMCQ-KKMIYCERSA-N |
| XLogP | 5.56 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|