C22H35NO5S — CID 59378178
propan-2-yl 5-[[(2R)-1-[(3S)-3-hydroxyoctyl]-5-oxopyrrolidin-2-yl]methoxymethyl]thiophene-2-carboxylate (PubChem CID 59378178) has the molecular formula C22H35NO5S and a molecular weight of 425.59 g/mol. Its IUPAC name is propan-2-yl 5-[[(2R)-1-[(3S)-3-hydroxyoctyl]-5-oxopyrrolidin-2-yl]methoxymethyl]thiophene-2-carboxylate.
| Compound Name | propan-2-yl 5-[[(2R)-1-[(3S)-3-hydroxyoctyl]-5-oxopyrrolidin-2-yl]methoxymethyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 59378178 |
| Molecular Formula | C22H35NO5S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | propan-2-yl 5-[[(2R)-1-[(3S)-3-hydroxyoctyl]-5-oxopyrrolidin-2-yl]methoxymethyl]thiophene-2-carboxylate |
| SMILES | CCCCC[C@H](O)CCN1C(=O)CC[C@@H]1COCc1ccc(C(=O)OC(C)C)s1 |
| InChI | InChI=1S/C22H35NO5S/c1-4-5-6-7-18(24)12-13-23-17(8-11-21(23)25)14-27-15-19-9-10-20(29-19)22(26)28-16(2)3/h9-10,16-18,24H,4-8,11-15H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | GZWGDDFVUBKJII-MSOLQXFVSA-N |
| XLogP | 4.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|