C21H34N2O4S — CID 68721434
N-ethyl-5-[[(4S)-4-hydroxy-1-(5-oxopyrrolidin-2-yl)nonoxy]methyl]thiophene-2-carboxamide (PubChem CID 68721434) has the molecular formula C21H34N2O4S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-ethyl-5-[[(4S)-4-hydroxy-1-(5-oxopyrrolidin-2-yl)nonoxy]methyl]thiophene-2-carboxamide.
| Compound Name | N-ethyl-5-[[(4S)-4-hydroxy-1-(5-oxopyrrolidin-2-yl)nonoxy]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 68721434 |
| Molecular Formula | C21H34N2O4S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-ethyl-5-[[(4S)-4-hydroxy-1-(5-oxopyrrolidin-2-yl)nonoxy]methyl]thiophene-2-carboxamide |
| SMILES | CCCCC[C@H](O)CCC(OCc1ccc(C(=O)NCC)s1)C1CCC(=O)N1 |
| InChI | InChI=1S/C21H34N2O4S/c1-3-5-6-7-15(24)8-11-18(17-10-13-20(25)23-17)27-14-16-9-12-19(28-16)21(26)22-4-2/h9,12,15,17-18,24H,3-8,10-11,13-14H2,1-2H3,(H,22,26)(H,23,25)/t15-,17?,18?/m0/s1 |
| InChIKey | LKKIQQVZAJWDPS-ZLPCBKJTSA-N |
| XLogP | 3.38 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|