C20H32N2O6S2 — CID 68605338
5-[(1R,4S)-4-hydroxy-1-[(5-oxopyrrolidin-2-yl)methoxy]nonyl]-N-methylsulfonylthiophene-2-carboxamide (PubChem CID 68605338) has the molecular formula C20H32N2O6S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 5-[(1R,4S)-4-hydroxy-1-[(5-oxopyrrolidin-2-yl)methoxy]nonyl]-N-methylsulfonylthiophene-2-carboxamide.
| Compound Name | 5-[(1R,4S)-4-hydroxy-1-[(5-oxopyrrolidin-2-yl)methoxy]nonyl]-N-methylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 68605338 |
| Molecular Formula | C20H32N2O6S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 5-[(1R,4S)-4-hydroxy-1-[(5-oxopyrrolidin-2-yl)methoxy]nonyl]-N-methylsulfonylthiophene-2-carboxamide |
| SMILES | CCCCC[C@H](O)CC[C@@H](OCC1CCC(=O)N1)c1ccc(C(=O)NS(C)(=O)=O)s1 |
| InChI | InChI=1S/C20H32N2O6S2/c1-3-4-5-6-15(23)8-9-16(28-13-14-7-12-19(24)21-14)17-10-11-18(29-17)20(25)22-30(2,26)27/h10-11,14-16,23H,3-9,12-13H2,1-2H3,(H,21,24)(H,22,25)/t14?,15-,16+/m0/s1 |
| InChIKey | WBLWDCGOLGDEJE-MERJSTESSA-N |
| XLogP | 2.50 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|