C26H34N2O4S — CID 91439202
propan-2-yl 5-[3-[3-(4-hexylphenyl)-5-hydroxy-2-oxo-1H-imidazol-4-yl]propyl]thiophene-2-carboxylate (PubChem CID 91439202) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is propan-2-yl 5-[3-[3-(4-hexylphenyl)-5-hydroxy-2-oxo-1H-imidazol-4-yl]propyl]thiophene-2-carboxylate.
| Compound Name | propan-2-yl 5-[3-[3-(4-hexylphenyl)-5-hydroxy-2-oxo-1H-imidazol-4-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 91439202 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | propan-2-yl 5-[3-[3-(4-hexylphenyl)-5-hydroxy-2-oxo-1H-imidazol-4-yl]propyl]thiophene-2-carboxylate |
| SMILES | CCCCCCc1ccc(-n2c(CCCc3ccc(C(=O)OC(C)C)s3)c(O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C26H34N2O4S/c1-4-5-6-7-9-19-12-14-20(15-13-19)28-22(24(29)27-26(28)31)11-8-10-21-16-17-23(33-21)25(30)32-18(2)3/h12-18,29H,4-11H2,1-3H3,(H,27,31) |
| InChIKey | XQDLKGXNJKUNHE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|