C28H35NO4S — CID 68703274
2-hydroxyethyl 5-[3-[3-cyano-2-[4-[(1S)-1-hydroxyhexyl]phenyl]cyclopent-2-en-1-yl]propyl]thiophene-2-carboxylate (PubChem CID 68703274) has the molecular formula C28H35NO4S and a molecular weight of 481.66 g/mol. Its IUPAC name is 2-hydroxyethyl 5-[3-[3-cyano-2-[4-[(1S)-1-hydroxyhexyl]phenyl]cyclopent-2-en-1-yl]propyl]thiophene-2-carboxylate.
| Compound Name | 2-hydroxyethyl 5-[3-[3-cyano-2-[4-[(1S)-1-hydroxyhexyl]phenyl]cyclopent-2-en-1-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 68703274 |
| Molecular Formula | C28H35NO4S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 2-hydroxyethyl 5-[3-[3-cyano-2-[4-[(1S)-1-hydroxyhexyl]phenyl]cyclopent-2-en-1-yl]propyl]thiophene-2-carboxylate |
| SMILES | CCCCC[C@H](O)c1ccc(C2=C(C#N)CCC2CCCc2ccc(C(=O)OCCO)s2)cc1 |
| InChI | InChI=1S/C28H35NO4S/c1-2-3-4-8-25(31)20-9-11-22(12-10-20)27-21(13-14-23(27)19-29)6-5-7-24-15-16-26(34-24)28(32)33-18-17-30/h9-12,15-16,21,25,30-31H,2-8,13-14,17-18H2,1H3/t21?,25-/m0/s1 |
| InChIKey | GAOKTNXDLBKUKQ-QBGQUKIHSA-N |
| XLogP | 6.22 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|