C25H32O4S — CID 88953806
5-[3-[(1S)-2-[4-(1,2-dihydroxyhexyl)phenyl]-3-oxocyclopentyl]propyl]thiophene-2-carbaldehyde (PubChem CID 88953806) has the molecular formula C25H32O4S and a molecular weight of 428.59 g/mol. Its IUPAC name is 5-[3-[(1S)-2-[4-(1,2-dihydroxyhexyl)phenyl]-3-oxocyclopentyl]propyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[3-[(1S)-2-[4-(1,2-dihydroxyhexyl)phenyl]-3-oxocyclopentyl]propyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 88953806 |
| Molecular Formula | C25H32O4S |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 5-[3-[(1S)-2-[4-(1,2-dihydroxyhexyl)phenyl]-3-oxocyclopentyl]propyl]thiophene-2-carbaldehyde |
| SMILES | CCCCC(O)C(O)c1ccc(C2C(=O)CC[C@@H]2CCCc2ccc(C=O)s2)cc1 |
| InChI | InChI=1S/C25H32O4S/c1-2-3-7-23(28)25(29)19-10-8-18(9-11-19)24-17(12-15-22(24)27)5-4-6-20-13-14-21(16-26)30-20/h8-11,13-14,16-17,23-25,28-29H,2-7,12,15H2,1H3/t17-,23?,24?,25?/m0/s1 |
| InChIKey | NGNKDMRGIFJPLW-LNPRERFQSA-N |
| XLogP | 5.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|