C25H34Cl2OS — CID 59815080
1-[4-[(1S,5S)-2,2-dichloro-5-[3-(5-methylthiophen-2-yl)propyl]cyclopentyl]phenyl]hexan-1-ol (PubChem CID 59815080) has the molecular formula C25H34Cl2OS and a molecular weight of 453.52 g/mol. Its IUPAC name is 1-[4-[(1S,5S)-2,2-dichloro-5-[3-(5-methylthiophen-2-yl)propyl]cyclopentyl]phenyl]hexan-1-ol.
| Compound Name | 1-[4-[(1S,5S)-2,2-dichloro-5-[3-(5-methylthiophen-2-yl)propyl]cyclopentyl]phenyl]hexan-1-ol |
|---|---|
| PubChem CID | 59815080 |
| Molecular Formula | C25H34Cl2OS |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 1-[4-[(1S,5S)-2,2-dichloro-5-[3-(5-methylthiophen-2-yl)propyl]cyclopentyl]phenyl]hexan-1-ol |
| SMILES | CCCCCC(O)c1ccc([C@@H]2[C@@H](CCCc3ccc(C)s3)CCC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C25H34Cl2OS/c1-3-4-5-9-23(28)19-11-13-21(14-12-19)24-20(16-17-25(24,26)27)7-6-8-22-15-10-18(2)29-22/h10-15,20,23-24,28H,3-9,16-17H2,1-2H3/t20-,23?,24-/m0/s1 |
| InChIKey | KEDXCPJUBFIHCT-PXTRNLTBSA-N |
| XLogP | 8.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|