C26H31NO3S — CID 59355130
5-[3-[(2S)-2-[4-(1-hydroxyhexyl)phenyl]-3-isocyanocyclopent-3-en-1-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 59355130) has the molecular formula C26H31NO3S and a molecular weight of 437.61 g/mol. Its IUPAC name is 5-[3-[(2S)-2-[4-(1-hydroxyhexyl)phenyl]-3-isocyanocyclopent-3-en-1-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(2S)-2-[4-(1-hydroxyhexyl)phenyl]-3-isocyanocyclopent-3-en-1-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59355130 |
| Molecular Formula | C26H31NO3S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 5-[3-[(2S)-2-[4-(1-hydroxyhexyl)phenyl]-3-isocyanocyclopent-3-en-1-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | [C-]#[N+]C1=CCC(CCCc2ccc(C(=O)O)s2)[C@H]1c1ccc(C(O)CCCCC)cc1 |
| InChI | InChI=1S/C26H31NO3S/c1-3-4-5-9-23(28)18-10-12-20(13-11-18)25-19(14-16-22(25)27-2)7-6-8-21-15-17-24(31-21)26(29)30/h10-13,15-17,19,23,25,28H,3-9,14H2,1H3,(H,29,30)/t19?,23?,25-/m0/s1 |
| InChIKey | USHLOVPBAVCUCU-XSIDSBFUSA-N |
| XLogP | 6.99 |
| TPSA | 61.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|