C24H29BrO3S — CID 59355131
5-[2-[(1S)-3-bromo-2-[4-(1-hydroxyhexyl)phenyl]cyclopent-3-en-1-yl]ethyl]thiophene-2-carboxylic acid (PubChem CID 59355131) has the molecular formula C24H29BrO3S and a molecular weight of 477.46 g/mol. Its IUPAC name is 5-[2-[(1S)-3-bromo-2-[4-(1-hydroxyhexyl)phenyl]cyclopent-3-en-1-yl]ethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[2-[(1S)-3-bromo-2-[4-(1-hydroxyhexyl)phenyl]cyclopent-3-en-1-yl]ethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59355131 |
| Molecular Formula | C24H29BrO3S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 5-[2-[(1S)-3-bromo-2-[4-(1-hydroxyhexyl)phenyl]cyclopent-3-en-1-yl]ethyl]thiophene-2-carboxylic acid |
| SMILES | CCCCCC(O)c1ccc(C2C(Br)=CC[C@@H]2CCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C24H29BrO3S/c1-2-3-4-5-21(26)16-6-8-17(9-7-16)23-18(11-14-20(23)25)10-12-19-13-15-22(29-19)24(27)28/h6-9,13-15,18,21,23,26H,2-5,10-12H2,1H3,(H,27,28)/t18-,21?,23?/m0/s1 |
| InChIKey | UAQLMGULCKNOEL-RHKCVOJBSA-N |
| XLogP | 7.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|