C26H33NO4S — CID 143727968
2-[5-[2-[(1R)-2-[4-(1-hydroxyhexyl)phenyl]-3-(nitrosomethyl)cyclopent-2-en-1-yl]ethyl]thiophen-2-yl]acetic acid (PubChem CID 143727968) has the molecular formula C26H33NO4S and a molecular weight of 455.62 g/mol. Its IUPAC name is 2-[5-[2-[(1R)-2-[4-(1-hydroxyhexyl)phenyl]-3-(nitrosomethyl)cyclopent-2-en-1-yl]ethyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[2-[(1R)-2-[4-(1-hydroxyhexyl)phenyl]-3-(nitrosomethyl)cyclopent-2-en-1-yl]ethyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 143727968 |
| Molecular Formula | C26H33NO4S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-[5-[2-[(1R)-2-[4-(1-hydroxyhexyl)phenyl]-3-(nitrosomethyl)cyclopent-2-en-1-yl]ethyl]thiophen-2-yl]acetic acid |
| SMILES | CCCCCC(O)c1ccc(C2=C(CN=O)CC[C@@H]2CCc2ccc(CC(=O)O)s2)cc1 |
| InChI | InChI=1S/C26H33NO4S/c1-2-3-4-5-24(28)18-6-8-19(9-7-18)26-20(10-11-21(26)17-27-31)12-13-22-14-15-23(32-22)16-25(29)30/h6-9,14-15,20,24,28H,2-5,10-13,16-17H2,1H3,(H,29,30)/t20-,24?/m1/s1 |
| InChIKey | LSBMQWPSIWJSHG-CGHJUBPDSA-N |
| XLogP | 6.55 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|