C24H29NO4S2 — CID 59166676
methyl 5-[3-[3-(4-hexanoylphenyl)-4-oxo-1,3-thiazolidin-2-yl]propyl]thiophene-2-carboxylate (PubChem CID 59166676) has the molecular formula C24H29NO4S2 and a molecular weight of 459.63 g/mol. Its IUPAC name is methyl 5-[3-[3-(4-hexanoylphenyl)-4-oxo-1,3-thiazolidin-2-yl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[3-(4-hexanoylphenyl)-4-oxo-1,3-thiazolidin-2-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 59166676 |
| Molecular Formula | C24H29NO4S2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | methyl 5-[3-[3-(4-hexanoylphenyl)-4-oxo-1,3-thiazolidin-2-yl]propyl]thiophene-2-carboxylate |
| SMILES | CCCCCC(=O)c1ccc(N2C(=O)CSC2CCCc2ccc(C(=O)OC)s2)cc1 |
| InChI | InChI=1S/C24H29NO4S2/c1-3-4-5-8-20(26)17-10-12-18(13-11-17)25-22(27)16-30-23(25)9-6-7-19-14-15-21(31-19)24(28)29-2/h10-15,23H,3-9,16H2,1-2H3 |
| InChIKey | BWJZBOULCJYCNT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|