C22H29NO6S2 — CID 67271266
methyl 5-[[2-(4-hexanoylphenyl)-1,1-dihydroxy-1,2-thiazolidin-3-yl]oxymethyl]thiophene-2-carboxylate (PubChem CID 67271266) has the molecular formula C22H29NO6S2 and a molecular weight of 467.61 g/mol. Its IUPAC name is methyl 5-[[2-(4-hexanoylphenyl)-1,1-dihydroxy-1,2-thiazolidin-3-yl]oxymethyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[[2-(4-hexanoylphenyl)-1,1-dihydroxy-1,2-thiazolidin-3-yl]oxymethyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 67271266 |
| Molecular Formula | C22H29NO6S2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | methyl 5-[[2-(4-hexanoylphenyl)-1,1-dihydroxy-1,2-thiazolidin-3-yl]oxymethyl]thiophene-2-carboxylate |
| SMILES | CCCCCC(=O)c1ccc(N2C(OCc3ccc(C(=O)OC)s3)CCS2(O)O)cc1 |
| InChI | InChI=1S/C22H29NO6S2/c1-3-4-5-6-19(24)16-7-9-17(10-8-16)23-21(13-14-31(23,26)27)29-15-18-11-12-20(30-18)22(25)28-2/h7-12,21,26-27H,3-6,13-15H2,1-2H3 |
| InChIKey | HKNSGZHYGKKYMC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|