C14H20O3S — CID 114196960
5-[(3-methylcyclohexyl)methoxymethyl]thiophene-2-carboxylic acid (PubChem CID 114196960) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is 5-[(3-methylcyclohexyl)methoxymethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(3-methylcyclohexyl)methoxymethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114196960 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5-[(3-methylcyclohexyl)methoxymethyl]thiophene-2-carboxylic acid |
| SMILES | CC1CCCC(COCc2ccc(C(=O)O)s2)C1 |
| InChI | InChI=1S/C14H20O3S/c1-10-3-2-4-11(7-10)8-17-9-12-5-6-13(18-12)14(15)16/h5-6,10-11H,2-4,7-9H2,1H3,(H,15,16) |
| InChIKey | VMQCBRRFOSWRIV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |