C22H28O3S — CID 158154531
3-[4-(1-hydroxypentyl)phenyl]-2-(thiophen-2-ylmethoxymethyl)cyclopentan-1-one (PubChem CID 158154531) has the molecular formula C22H28O3S and a molecular weight of 372.53 g/mol. Its IUPAC name is 3-[4-(1-hydroxypentyl)phenyl]-2-(thiophen-2-ylmethoxymethyl)cyclopentan-1-one.
| Compound Name | 3-[4-(1-hydroxypentyl)phenyl]-2-(thiophen-2-ylmethoxymethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 158154531 |
| Molecular Formula | C22H28O3S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 3-[4-(1-hydroxypentyl)phenyl]-2-(thiophen-2-ylmethoxymethyl)cyclopentan-1-one |
| SMILES | CCCCC(O)c1ccc(C2CCC(=O)C2COCc2cccs2)cc1 |
| InChI | InChI=1S/C22H28O3S/c1-2-3-6-21(23)17-9-7-16(8-10-17)19-11-12-22(24)20(19)15-25-14-18-5-4-13-26-18/h4-5,7-10,13,19-21,23H,2-3,6,11-12,14-15H2,1H3 |
| InChIKey | XMHNHDCIROYCIY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |