C26H31NO5S — CID 174754420
propan-2-yl 5-[[4-(1-hydroxyhexyl)phenyl]-[(5-oxopyrrol-2-yl)methoxy]methyl]thiophene-2-carboxylate (PubChem CID 174754420) has the molecular formula C26H31NO5S and a molecular weight of 469.60 g/mol. Its IUPAC name is propan-2-yl 5-[[4-(1-hydroxyhexyl)phenyl]-[(5-oxopyrrol-2-yl)methoxy]methyl]thiophene-2-carboxylate.
| Compound Name | propan-2-yl 5-[[4-(1-hydroxyhexyl)phenyl]-[(5-oxopyrrol-2-yl)methoxy]methyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 174754420 |
| Molecular Formula | C26H31NO5S |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | propan-2-yl 5-[[4-(1-hydroxyhexyl)phenyl]-[(5-oxopyrrol-2-yl)methoxy]methyl]thiophene-2-carboxylate |
| SMILES | CCCCCC(O)c1ccc(C(OCC2=NC(=O)C=C2)c2ccc(C(=O)OC(C)C)s2)cc1 |
| InChI | InChI=1S/C26H31NO5S/c1-4-5-6-7-21(28)18-8-10-19(11-9-18)25(31-16-20-12-15-24(29)27-20)22-13-14-23(33-22)26(30)32-17(2)3/h8-15,17,21,25,28H,4-7,16H2,1-3H3 |
| InChIKey | RDOGECGRQQNOSC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|