C21H34O3 — CID 163110898
3-[2-(1,4-dihydroxynon-2-enyl)cyclopropyl]cyclonon-5-en-1-one (PubChem CID 163110898) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 3-[2-(1,4-dihydroxynon-2-enyl)cyclopropyl]cyclonon-5-en-1-one.
| Compound Name | 3-[2-(1,4-dihydroxynon-2-enyl)cyclopropyl]cyclonon-5-en-1-one |
|---|---|
| PubChem CID | 163110898 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 3-[2-(1,4-dihydroxynon-2-enyl)cyclopropyl]cyclonon-5-en-1-one |
| SMILES | CCCCCC(O)C=CC(O)C1CC1C1CC=CCCCC(=O)C1 |
| InChI | InChI=1S/C21H34O3/c1-2-3-6-10-17(22)12-13-21(24)20-15-19(20)16-9-7-4-5-8-11-18(23)14-16/h4,7,12-13,16-17,19-22,24H,2-3,5-6,8-11,14-15H2,1H3 |
| InChIKey | LSHDKABVPJCRGL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|