C26H38F2O5 — CID 139600983
(5E)-5-[(3aS,4S,5R,6aS)-4-[(E)-4,4-difluoro-8-oxooct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid (PubChem CID 139600983) has the molecular formula C26H38F2O5 and a molecular weight of 468.58 g/mol. Its IUPAC name is (5E)-5-[(3aS,4S,5R,6aS)-4-[(E)-4,4-difluoro-8-oxooct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid.
| Compound Name | (5E)-5-[(3aS,4S,5R,6aS)-4-[(E)-4,4-difluoro-8-oxooct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 139600983 |
| Molecular Formula | C26H38F2O5 |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (5E)-5-[(3aS,4S,5R,6aS)-4-[(E)-4,4-difluoro-8-oxooct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
| SMILES | O=CCCCC(F)(F)C/C=C/[C@H]1[C@H]2C/C(=C/CCCC(=O)O)C[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C26H38F2O5/c27-26(28,12-4-5-14-29)13-7-9-21-22-17-19(8-1-2-10-24(30)31)16-20(22)18-23(21)33-25-11-3-6-15-32-25/h7-9,14,20-23,25H,1-6,10-13,15-18H2,(H,30,31)/b9-7+,19-8+/t20-,21-,22-,23+,25?/m0/s1 |
| InChIKey | FVRKORXQFGIISA-FREVEJDNSA-N |
| XLogP | 6.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|