C26H34F2O5 — CID 70276092
(5E)-5-[(3aS,5R,6aS)-4-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-[[(2S)-2H-pyran-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid (PubChem CID 70276092) has the molecular formula C26H34F2O5 and a molecular weight of 464.55 g/mol. Its IUPAC name is (5E)-5-[(3aS,5R,6aS)-4-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-[[(2S)-2H-pyran-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid.
| Compound Name | (5E)-5-[(3aS,5R,6aS)-4-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-[[(2S)-2H-pyran-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 70276092 |
| Molecular Formula | C26H34F2O5 |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | (5E)-5-[(3aS,5R,6aS)-4-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-[[(2S)-2H-pyran-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
| SMILES | CCCCC(F)(F)C(=O)/C=C/C1[C@H]2C/C(=C/CCCC(=O)O)C[C@H]2C[C@H]1O[C@H]1C=CC=CO1 |
| InChI | InChI=1S/C26H34F2O5/c1-2-3-13-26(27,28)23(29)12-11-20-21-16-18(8-4-5-9-24(30)31)15-19(21)17-22(20)33-25-10-6-7-14-32-25/h6-8,10-12,14,19-22,25H,2-5,9,13,15-17H2,1H3,(H,30,31)/b12-11+,18-8+/t19-,20?,21-,22+,25-/m0/s1 |
| InChIKey | IFJXBRJCORJUGN-SWIPKESESA-N |
| XLogP | 5.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|