C30H43FO5 — CID 56611633
2-[(3aS,4S,5R,6aS)-4-[(3S)-4,4-dimethyl-3-(oxan-2-yloxy)octa-1,6-diynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-fluoroethanol (PubChem CID 56611633) has the molecular formula C30H43FO5 and a molecular weight of 502.67 g/mol. Its IUPAC name is 2-[(3aS,4S,5R,6aS)-4-[(3S)-4,4-dimethyl-3-(oxan-2-yloxy)octa-1,6-diynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-fluoroethanol.
| Compound Name | 2-[(3aS,4S,5R,6aS)-4-[(3S)-4,4-dimethyl-3-(oxan-2-yloxy)octa-1,6-diynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-fluoroethanol |
|---|---|
| PubChem CID | 56611633 |
| Molecular Formula | C30H43FO5 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | 2-[(3aS,4S,5R,6aS)-4-[(3S)-4,4-dimethyl-3-(oxan-2-yloxy)octa-1,6-diynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-fluoroethanol |
| SMILES | CC#CCC(C)(C)[C@@H](C#C[C@@H]1[C@H]2CC(=C(F)CO)C[C@H]2C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C30H43FO5/c1-4-5-14-30(2,3)27(36-29-11-7-9-16-34-29)13-12-23-24-18-22(25(31)20-32)17-21(24)19-26(23)35-28-10-6-8-15-33-28/h21,23-24,26-29,32H,6-11,14-20H2,1-3H3/t21-,23+,24-,26+,27+,28?,29?/m0/s1 |
| InChIKey | KSBPFFRNUXAEBE-FKAHBJCHSA-N |
| XLogP | 5.51 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|