C30H47FO5 — CID 67916342
2-[(3aS,4R,5R,6aS)-4-[(1E,3R)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-fluoroethanol (PubChem CID 67916342) has the molecular formula C30H47FO5 and a molecular weight of 506.70 g/mol. Its IUPAC name is 2-[(3aS,4R,5R,6aS)-4-[(1E,3R)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-fluoroethanol.
| Compound Name | 2-[(3aS,4R,5R,6aS)-4-[(1E,3R)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-fluoroethanol |
|---|---|
| PubChem CID | 67916342 |
| Molecular Formula | C30H47FO5 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 2-[(3aS,4R,5R,6aS)-4-[(1E,3R)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-fluoroethanol |
| SMILES | CC(C)=CCC(C)[C@H](/C=C/[C@@H]1[C@H]2CC(=C(F)CO)C[C@H]2C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C30H47FO5/c1-20(2)10-11-21(3)27(35-29-8-4-6-14-33-29)13-12-24-25-17-23(26(31)19-32)16-22(25)18-28(24)36-30-9-5-7-15-34-30/h10,12-13,21-22,24-25,27-30,32H,4-9,11,14-19H2,1-3H3/b13-12+,26-23?/t21?,22-,24+,25-,27-,28+,29?,30?/m0/s1 |
| InChIKey | ASYMQNGJIRAIAB-MOAZJIJASA-N |
| XLogP | 6.62 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|