C32H47FO5 — CID 67916263
(2E)-2-[(3aS,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E,3R)-3-(oxan-2-yloxy)-3-(1-pent-2-ynylcyclobutyl)prop-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-fluoroethanol (PubChem CID 67916263) has the molecular formula C32H47FO5 and a molecular weight of 530.72 g/mol. Its IUPAC name is (2E)-2-[(3aS,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E,3R)-3-(oxan-2-yloxy)-3-(1-pent-2-ynylcyclobutyl)prop-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-fluoroethanol.
| Compound Name | (2E)-2-[(3aS,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E,3R)-3-(oxan-2-yloxy)-3-(1-pent-2-ynylcyclobutyl)prop-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-fluoroethanol |
|---|---|
| PubChem CID | 67916263 |
| Molecular Formula | C32H47FO5 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | (2E)-2-[(3aS,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E,3R)-3-(oxan-2-yloxy)-3-(1-pent-2-ynylcyclobutyl)prop-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-fluoroethanol |
| SMILES | CCC#CCC1([C@@H](/C=C/[C@@H]2[C@H]3C/C(=C(/F)CO)C[C@H]3C[C@H]2OC2CCCCO2)OC2CCCCO2)CCC1 |
| InChI | InChI=1S/C32H47FO5/c1-2-3-6-14-32(15-9-16-32)29(38-31-11-5-8-18-36-31)13-12-25-26-20-24(27(33)22-34)19-23(26)21-28(25)37-30-10-4-7-17-35-30/h12-13,23,25-26,28-31,34H,2,4-5,7-11,14-22H2,1H3/b13-12+,27-24+/t23-,25+,26-,28+,29+,30?,31?/m0/s1 |
| InChIKey | MNHARBFEUOWSFS-LIOCROBPSA-N |
| XLogP | 6.60 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|