C32H46O5 — CID 57035959
2-[(3aS,4S,5R,6aS)-5-(oxan-2-yloxy)-4-[3-(oxan-2-yloxy)-3-(1-pent-2-ynylcyclobutyl)prop-1-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol (PubChem CID 57035959) has the molecular formula C32H46O5 and a molecular weight of 510.72 g/mol. Its IUPAC name is 2-[(3aS,4S,5R,6aS)-5-(oxan-2-yloxy)-4-[3-(oxan-2-yloxy)-3-(1-pent-2-ynylcyclobutyl)prop-1-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol.
| Compound Name | 2-[(3aS,4S,5R,6aS)-5-(oxan-2-yloxy)-4-[3-(oxan-2-yloxy)-3-(1-pent-2-ynylcyclobutyl)prop-1-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol |
|---|---|
| PubChem CID | 57035959 |
| Molecular Formula | C32H46O5 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | 2-[(3aS,4S,5R,6aS)-5-(oxan-2-yloxy)-4-[3-(oxan-2-yloxy)-3-(1-pent-2-ynylcyclobutyl)prop-1-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol |
| SMILES | CCC#CCC1(C(C#C[C@@H]2[C@H]3CC(=CCO)C[C@H]3C[C@H]2OC2CCCCO2)OC2CCCCO2)CCC1 |
| InChI | InChI=1S/C32H46O5/c1-2-3-6-15-32(16-9-17-32)29(37-31-11-5-8-20-35-31)13-12-26-27-22-24(14-18-33)21-25(27)23-28(26)36-30-10-4-7-19-34-30/h14,25-31,33H,2,4-5,7-11,15-23H2,1H3/t25-,26+,27-,28+,29?,30?,31?/m0/s1 |
| InChIKey | BFEZYWDSSYLOOQ-PDNFJMIJSA-N |
| XLogP | 5.75 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|