C23H34IO3P — CID 146208521
methyl 5-[(3aS,5R,6aS)-5-iodophosphanyloxy-4-[(E)-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate (PubChem CID 146208521) has the molecular formula C23H34IO3P and a molecular weight of 516.40 g/mol. Its IUPAC name is methyl 5-[(3aS,5R,6aS)-5-iodophosphanyloxy-4-[(E)-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate.
| Compound Name | methyl 5-[(3aS,5R,6aS)-5-iodophosphanyloxy-4-[(E)-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 146208521 |
| Molecular Formula | C23H34IO3P |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | methyl 5-[(3aS,5R,6aS)-5-iodophosphanyloxy-4-[(E)-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
| SMILES | CC#CCC(C)C/C=C/C1[C@H]2CC(=CCCCC(=O)OC)C[C@H]2C[C@H]1OPI |
| InChI | InChI=1S/C23H34IO3P/c1-4-5-9-17(2)10-8-12-20-21-15-18(11-6-7-13-23(25)26-3)14-19(21)16-22(20)27-28-24/h8,11-12,17,19-22,28H,6-7,9-10,13-16H2,1-3H3/b12-8+,18-11?/t17?,19-,20?,21-,22+/m0/s1 |
| InChIKey | PTMWJHMJKIWVBU-TYVNHHQYSA-N |
| XLogP | 6.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|