C23H34O2 — CID 170381567
methyl (5E)-5-[(3aS,6aR)-4-[(E)-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate (PubChem CID 170381567) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is methyl (5E)-5-[(3aS,6aR)-4-[(E)-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate.
| Compound Name | methyl (5E)-5-[(3aS,6aR)-4-[(E)-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 170381567 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | methyl (5E)-5-[(3aS,6aR)-4-[(E)-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
| SMILES | CC#CCC(C)C/C=C/C1CC[C@@H]2C/C(=C\CCCC(=O)OC)C[C@H]12 |
| InChI | InChI=1S/C23H34O2/c1-4-5-9-18(2)10-8-12-20-14-15-21-16-19(17-22(20)21)11-6-7-13-23(24)25-3/h8,11-12,18,20-22H,6-7,9-10,13-17H2,1-3H3/b12-8+,19-11+/t18?,20?,21-,22-/m1/s1 |
| InChIKey | OBAPCQDAMFZLKY-JWRFPCCNSA-N |
| XLogP | 5.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|