C24H36O5 — CID 144639015
acetic acid;(5E)-5-[4-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid (PubChem CID 144639015) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is acetic acid;(5E)-5-[4-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid.
| Compound Name | acetic acid;(5E)-5-[4-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 144639015 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | acetic acid;(5E)-5-[4-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
| SMILES | CC#CCC(C)C(O)/C=C/C1CCC2C/C(=C\CCCC(=O)O)CC12.CC(=O)O |
| InChI | InChI=1S/C22H32O3.C2H4O2/c1-3-4-7-16(2)21(23)13-12-18-10-11-19-14-17(15-20(18)19)8-5-6-9-22(24)25;1-2(3)4/h8,12-13,16,18-21,23H,5-7,9-11,14-15H2,1-2H3,(H,24,25);1H3,(H,3,4)/b13-12+,17-8+; |
| InChIKey | AVMQKYXHRBAJFV-IMOPHDCASA-N |
| XLogP | 4.66 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|