C32H42O6 — CID 70895948
[(1S)-2-ethoxy-2-oxo-1-phenylethyl] 5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate (PubChem CID 70895948) has the molecular formula C32H42O6 and a molecular weight of 522.68 g/mol. Its IUPAC name is [(1S)-2-ethoxy-2-oxo-1-phenylethyl] 5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate.
| Compound Name | [(1S)-2-ethoxy-2-oxo-1-phenylethyl] 5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 70895948 |
| Molecular Formula | C32H42O6 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | [(1S)-2-ethoxy-2-oxo-1-phenylethyl] 5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
| SMILES | CC#CCC(C)[C@H](O)C=C[C@@H]1[C@H]2CC(=CCCCC(=O)O[C@H](C(=O)OCC)c3ccccc3)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C32H42O6/c1-4-6-12-22(3)28(33)18-17-26-27-20-23(19-25(27)21-29(26)34)13-10-11-16-30(35)38-31(32(36)37-5-2)24-14-8-7-9-15-24/h7-9,13-15,17-18,22,25-29,31,33-34H,5,10-12,16,19-21H2,1-3H3/t22?,25-,26+,27-,28+,29+,31-/m0/s1 |
| InChIKey | NYCOCLLKYZPEID-AHOJVKNVSA-N |
| XLogP | 5.30 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|