C28H39NO3 — CID 91065332
5-[(3aS,4R,5R,6aS)-4-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-N-benzylpentanamide (PubChem CID 91065332) has the molecular formula C28H39NO3 and a molecular weight of 437.62 g/mol. Its IUPAC name is 5-[(3aS,4R,5R,6aS)-4-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-N-benzylpentanamide.
| Compound Name | 5-[(3aS,4R,5R,6aS)-4-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-N-benzylpentanamide |
|---|---|
| PubChem CID | 91065332 |
| Molecular Formula | C28H39NO3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | 5-[(3aS,4R,5R,6aS)-4-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-N-benzylpentanamide |
| SMILES | O=C(CCCC=C1C[C@H]2C[C@@H](O)[C@H](C=C[C@@H](O)C3CCCC3)[C@H]2C1)NCc1ccccc1 |
| InChI | InChI=1S/C28H39NO3/c30-26(22-11-5-6-12-22)15-14-24-25-17-21(16-23(25)18-27(24)31)10-4-7-13-28(32)29-19-20-8-2-1-3-9-20/h1-3,8-10,14-15,22-27,30-31H,4-7,11-13,16-19H2,(H,29,32)/t23-,24+,25-,26+,27+/m0/s1 |
| InChIKey | KENKFQVKQHSVHX-XQDVFQCSSA-N |
| XLogP | 4.91 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|