C15H24F2O4 — CID 88825255
2-[(1S,2S,3S,5R)-2-[(3S)-4,4-difluoro-3-hydroxyoct-1-enyl]-3,5-dihydroxycyclopentyl]acetaldehyde (PubChem CID 88825255) has the molecular formula C15H24F2O4 and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-[(1S,2S,3S,5R)-2-[(3S)-4,4-difluoro-3-hydroxyoct-1-enyl]-3,5-dihydroxycyclopentyl]acetaldehyde.
| Compound Name | 2-[(1S,2S,3S,5R)-2-[(3S)-4,4-difluoro-3-hydroxyoct-1-enyl]-3,5-dihydroxycyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 88825255 |
| Molecular Formula | C15H24F2O4 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-[(1S,2S,3S,5R)-2-[(3S)-4,4-difluoro-3-hydroxyoct-1-enyl]-3,5-dihydroxycyclopentyl]acetaldehyde |
| SMILES | CCCCC(F)(F)[C@@H](O)C=C[C@H]1[C@H](CC=O)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C15H24F2O4/c1-2-3-7-15(16,17)14(21)5-4-10-11(6-8-18)13(20)9-12(10)19/h4-5,8,10-14,19-21H,2-3,6-7,9H2,1H3/t10-,11-,12-,13+,14-/m0/s1 |
| InChIKey | JMZYZAYEEKNENM-YHQUGGNUSA-N |
| XLogP | 1.68 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|