C15H26F2O — CID 162547642
(E)-1-cyclopentyl-4,4-difluorodec-1-en-3-ol (PubChem CID 162547642) has the molecular formula C15H26F2O and a molecular weight of 260.37 g/mol. Its IUPAC name is (E)-1-cyclopentyl-4,4-difluorodec-1-en-3-ol.
| Compound Name | (E)-1-cyclopentyl-4,4-difluorodec-1-en-3-ol |
|---|---|
| PubChem CID | 162547642 |
| Molecular Formula | C15H26F2O |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | (E)-1-cyclopentyl-4,4-difluorodec-1-en-3-ol |
| SMILES | CCCCCCC(F)(F)C(O)/C=C/C1CCCC1 |
| InChI | InChI=1S/C15H26F2O/c1-2-3-4-7-12-15(16,17)14(18)11-10-13-8-5-6-9-13/h10-11,13-14,18H,2-9,12H2,1H3/b11-10+ |
| InChIKey | STBLBDIBBBWJDI-ZHACJKMWSA-N |
| XLogP | 4.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|