C12H18F3NO — CID 102092702
(E,3R)-5-cyclohexyl-3-(trifluoromethyl)pent-4-enamide (PubChem CID 102092702) has the molecular formula C12H18F3NO and a molecular weight of 249.28 g/mol. Its IUPAC name is (E,3R)-5-cyclohexyl-3-(trifluoromethyl)pent-4-enamide.
| Compound Name | (E,3R)-5-cyclohexyl-3-(trifluoromethyl)pent-4-enamide |
|---|---|
| PubChem CID | 102092702 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (E,3R)-5-cyclohexyl-3-(trifluoromethyl)pent-4-enamide |
| SMILES | NC(=O)CC(/C=C/C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H18F3NO/c13-12(14,15)10(8-11(16)17)7-6-9-4-2-1-3-5-9/h6-7,9-10H,1-5,8H2,(H2,16,17)/b7-6+ |
| InChIKey | TUYYINSKDMLEPQ-VOTSOKGWSA-N |
| XLogP | 3.18 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|