C21H35NO4 — CID 172862803
6-[2-(8-cyano-3-hydroxy-3-methyloct-1-enyl)-5-hydroxycyclopentyl]hexanoic acid (PubChem CID 172862803) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is 6-[2-(8-cyano-3-hydroxy-3-methyloct-1-enyl)-5-hydroxycyclopentyl]hexanoic acid.
| Compound Name | 6-[2-(8-cyano-3-hydroxy-3-methyloct-1-enyl)-5-hydroxycyclopentyl]hexanoic acid |
|---|---|
| PubChem CID | 172862803 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 6-[2-(8-cyano-3-hydroxy-3-methyloct-1-enyl)-5-hydroxycyclopentyl]hexanoic acid |
| SMILES | CC(O)(C=CC1CCC(O)C1CCCCCC(=O)O)CCCCCC#N |
| InChI | InChI=1S/C21H35NO4/c1-21(26,14-7-2-3-8-16-22)15-13-17-11-12-19(23)18(17)9-5-4-6-10-20(24)25/h13,15,17-19,23,26H,2-12,14H2,1H3,(H,24,25) |
| InChIKey | ZOUGFEGDJXXMHZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|