C21H32O5 — CID 22810203
5-[(2S,3aR,4R,6aS)-5-hydroxy-4-[(E)-3-hydroxy-3-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid (PubChem CID 22810203) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 5-[(2S,3aR,4R,6aS)-5-hydroxy-4-[(E)-3-hydroxy-3-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid.
| Compound Name | 5-[(2S,3aR,4R,6aS)-5-hydroxy-4-[(E)-3-hydroxy-3-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 22810203 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 5-[(2S,3aR,4R,6aS)-5-hydroxy-4-[(E)-3-hydroxy-3-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid |
| SMILES | CC#CCCC(C)(O)/C=C/[C@H]1C(O)C[C@@H]2O[C@@H](CCCCC(=O)O)C[C@@H]21 |
| InChI | InChI=1S/C21H32O5/c1-3-4-7-11-21(2,25)12-10-16-17-13-15(8-5-6-9-20(23)24)26-19(17)14-18(16)22/h10,12,15-19,22,25H,5-9,11,13-14H2,1-2H3,(H,23,24)/b12-10+/t15-,16+,17+,18?,19-,21?/m0/s1 |
| InChIKey | IDSSEHDEIFDOJX-XTGJMCITSA-N |
| XLogP | 2.90 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|