C23H38O5 — CID 22810270
5-[(2S,3aR,4R,5R,6aS)-5-hydroxy-4-[(1E,3R)-3-hydroxy-4,4,7-trimethylocta-1,6-dienyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid (PubChem CID 22810270) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is 5-[(2S,3aR,4R,5R,6aS)-5-hydroxy-4-[(1E,3R)-3-hydroxy-4,4,7-trimethylocta-1,6-dienyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid.
| Compound Name | 5-[(2S,3aR,4R,5R,6aS)-5-hydroxy-4-[(1E,3R)-3-hydroxy-4,4,7-trimethylocta-1,6-dienyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 22810270 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 5-[(2S,3aR,4R,5R,6aS)-5-hydroxy-4-[(1E,3R)-3-hydroxy-4,4,7-trimethylocta-1,6-dienyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoic acid |
| SMILES | CC(C)=CCC(C)(C)[C@H](O)/C=C/[C@@H]1[C@H]2C[C@H](CCCCC(=O)O)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C23H38O5/c1-15(2)11-12-23(3,4)21(25)10-9-17-18-13-16(7-5-6-8-22(26)27)28-20(18)14-19(17)24/h9-11,16-21,24-25H,5-8,12-14H2,1-4H3,(H,26,27)/b10-9+/t16-,17+,18+,19+,20-,21+/m0/s1 |
| InChIKey | JBYPTEPLJVIGTK-NJHQXWEDSA-N |
| XLogP | 4.09 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|