C23H38O5 — CID 70531867
methyl 5-[(3aR,4R,5R,6aR)-4-[(E,3S)-4-cyclopentyl-3-hydroxypent-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoate (PubChem CID 70531867) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is methyl 5-[(3aR,4R,5R,6aR)-4-[(E,3S)-4-cyclopentyl-3-hydroxypent-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aR,4R,5R,6aR)-4-[(E,3S)-4-cyclopentyl-3-hydroxypent-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoate |
|---|---|
| PubChem CID | 70531867 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | methyl 5-[(3aR,4R,5R,6aR)-4-[(E,3S)-4-cyclopentyl-3-hydroxypent-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoate |
| SMILES | COC(=O)CCCCC1C[C@@H]2[C@@H](/C=C/[C@H](O)C(C)C3CCCC3)[C@H](O)C[C@H]2O1 |
| InChI | InChI=1S/C23H38O5/c1-15(16-7-3-4-8-16)20(24)12-11-18-19-13-17(28-22(19)14-21(18)25)9-5-6-10-23(26)27-2/h11-12,15-22,24-25H,3-10,13-14H2,1-2H3/b12-11+/t15?,17?,18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | RKBDUQFRNVYKGS-SGKBNTFNSA-N |
| XLogP | 3.62 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|